C26H33ClN2O3 — CID 10928578
ethyl (3R)-1-[2-[2-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethyl]piperidine-3-carboxylate (PubChem CID 10928578) has the molecular formula C26H33ClN2O3 and a molecular weight of 457.01 g/mol. Its IUPAC name is ethyl (3R)-1-[2-[2-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-[2-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 10928578 |
| Molecular Formula | C26H33ClN2O3 |
| Molecular Weight | 457.01 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | ethyl (3R)-1-[2-[2-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethoxy]ethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(CCOCCN2c3ccccc3CCc3ccc(Cl)cc32)C1 |
| InChI | InChI=1S/C26H33ClN2O3/c1-2-32-26(30)22-7-5-13-28(19-22)14-16-31-17-15-29-24-8-4-3-6-20(24)9-10-21-11-12-23(27)18-25(21)29/h3-4,6,8,11-12,18,22H,2,5,7,9-10,13-17,19H2,1H3/t22-/m1/s1 |
| InChIKey | LSYPYBAKNZLPPU-JOCHJYFZSA-N |
| XLogP | 4.87 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.01 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|