C15H13Br2NO6 — CID 10928682
dimethyl 2-(2,6-dibromo-1-methoxycarbonylindol-3-yl)propanedioate (PubChem CID 10928682) has the molecular formula C15H13Br2NO6 and a molecular weight of 463.08 g/mol. Its IUPAC name is dimethyl 2-(2,6-dibromo-1-methoxycarbonylindol-3-yl)propanedioate.
| Compound Name | dimethyl 2-(2,6-dibromo-1-methoxycarbonylindol-3-yl)propanedioate |
|---|---|
| PubChem CID | 10928682 |
| Molecular Formula | C15H13Br2NO6 |
| Molecular Weight | 463.08 g/mol |
| Exact Mass | 460.91 |
| IUPAC Name | dimethyl 2-(2,6-dibromo-1-methoxycarbonylindol-3-yl)propanedioate |
| SMILES | COC(=O)C(C(=O)OC)c1c(Br)n(C(=O)OC)c2cc(Br)ccc12 |
| InChI | InChI=1S/C15H13Br2NO6/c1-22-13(19)11(14(20)23-2)10-8-5-4-7(16)6-9(8)18(12(10)17)15(21)24-3/h4-6,11H,1-3H3 |
| InChIKey | UFPJDKGPUUKFNP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.08 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|