About methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate
methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate (PubChem CID 155401651) has the molecular formula C19H28BrNO2S
and a molecular weight of 414.41 g/mol. Its IUPAC name is methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate |
| PubChem CID | 155401651 |
| Molecular Formula | C19H28BrNO2S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn(S(C(C)C)(C(C)C)C(C)C)c2cc(Br)ccc12 |
| InChI | InChI=1S/C19H28BrNO2S/c1-12(2)24(13(3)4,14(5)6)21-11-17(19(22)23-7)16-9-8-15(20)10-18(16)21/h8-14H,1-7H3 |
| InChIKey | MYPWQHAZNLGIKU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate?
The IUPAC name of methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate (CID 155401651) is methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate.
What is the SMILES notation for methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate?
The canonical SMILES for methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate is COC(=O)c1cn(S(C(C)C)(C(C)C)C(C)C)c2cc(Br)ccc12.
What is the InChIKey of methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate?
The InChIKey is MYPWQHAZNLGIKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28BrNO2S/c1-12(2)24(13(3)4,14(5)6)21-11-17(19(22)23-7)16-9-8-15(20)10-18(16)21/h8-14H,1-7H3.
What are the key properties of methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate?
methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate has a molecular weight of 414.41 g/mol, XLogP of 5.98, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-bromo-1-[tri(propan-2-yl)-λ4-sulfanyl]indole-3-carboxylate is sourced from PubChem (CID 155401651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).