C20H18F2N4O — CID 109287128
N-(3,4-difluorophenyl)-5-(3-phenylpropylamino)pyrazine-2-carboxamide (PubChem CID 109287128) has the molecular formula C20H18F2N4O and a molecular weight of 368.39 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-5-(3-phenylpropylamino)pyrazine-2-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-5-(3-phenylpropylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109287128 |
| Molecular Formula | C20H18F2N4O |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-(3,4-difluorophenyl)-5-(3-phenylpropylamino)pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1cnc(NCCCc2ccccc2)cn1 |
| InChI | InChI=1S/C20H18F2N4O/c21-16-9-8-15(11-17(16)22)26-20(27)18-12-25-19(13-24-18)23-10-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,11-13H,4,7,10H2,(H,23,25)(H,26,27) |
| InChIKey | KQLNUQRRQVFHJT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|