C18H24N4O — CID 109287251
N-tert-butyl-5-(2,4,6-trimethylanilino)pyrazine-2-carboxamide (PubChem CID 109287251) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-tert-butyl-5-(2,4,6-trimethylanilino)pyrazine-2-carboxamide.
| Compound Name | N-tert-butyl-5-(2,4,6-trimethylanilino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109287251 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-tert-butyl-5-(2,4,6-trimethylanilino)pyrazine-2-carboxamide |
| SMILES | Cc1cc(C)c(Nc2cnc(C(=O)NC(C)(C)C)cn2)c(C)c1 |
| InChI | InChI=1S/C18H24N4O/c1-11-7-12(2)16(13(3)8-11)21-15-10-19-14(9-20-15)17(23)22-18(4,5)6/h7-10H,1-6H3,(H,20,21)(H,22,23) |
| InChIKey | MHZHSXFPTXSZEP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |