C20H29N5O — CID 109287329
N-tert-butyl-5-[4-(diethylamino)-2-methylanilino]pyrazine-2-carboxamide (PubChem CID 109287329) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is N-tert-butyl-5-[4-(diethylamino)-2-methylanilino]pyrazine-2-carboxamide.
| Compound Name | N-tert-butyl-5-[4-(diethylamino)-2-methylanilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109287329 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | N-tert-butyl-5-[4-(diethylamino)-2-methylanilino]pyrazine-2-carboxamide |
| SMILES | CCN(CC)c1ccc(Nc2cnc(C(=O)NC(C)(C)C)cn2)c(C)c1 |
| InChI | InChI=1S/C20H29N5O/c1-7-25(8-2)15-9-10-16(14(3)11-15)23-18-13-21-17(12-22-18)19(26)24-20(4,5)6/h9-13H,7-8H2,1-6H3,(H,22,23)(H,24,26) |
| InChIKey | IDLVAJSEURBPGD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|