C22H33N5O — CID 109289101
N-[4-(diethylamino)-2-methylphenyl]-5-(dipropylamino)pyrazine-2-carboxamide (PubChem CID 109289101) has the molecular formula C22H33N5O and a molecular weight of 383.54 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-5-(dipropylamino)pyrazine-2-carboxamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-5-(dipropylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109289101 |
| Molecular Formula | C22H33N5O |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-5-(dipropylamino)pyrazine-2-carboxamide |
| SMILES | CCCN(CCC)c1cnc(C(=O)Nc2ccc(N(CC)CC)cc2C)cn1 |
| InChI | InChI=1S/C22H33N5O/c1-6-12-27(13-7-2)21-16-23-20(15-24-21)22(28)25-19-11-10-18(14-17(19)5)26(8-3)9-4/h10-11,14-16H,6-9,12-13H2,1-5H3,(H,25,28) |
| InChIKey | RVYOHEFMZVGZAJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|