C22H30N4O — CID 109287489
5-(2-tert-butylanilino)-N-cycloheptylpyrazine-2-carboxamide (PubChem CID 109287489) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 5-(2-tert-butylanilino)-N-cycloheptylpyrazine-2-carboxamide.
| Compound Name | 5-(2-tert-butylanilino)-N-cycloheptylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109287489 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 5-(2-tert-butylanilino)-N-cycloheptylpyrazine-2-carboxamide |
| SMILES | CC(C)(C)c1ccccc1Nc1cnc(C(=O)NC2CCCCCC2)cn1 |
| InChI | InChI=1S/C22H30N4O/c1-22(2,3)17-12-8-9-13-18(17)26-20-15-23-19(14-24-20)21(27)25-16-10-6-4-5-7-11-16/h8-9,12-16H,4-7,10-11H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | DBVFUCVTNUFGJI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |