C22H30N4O — CID 113018093
1-[6-(2-tert-butylanilino)-3-pyridinyl]-3-cyclohexylurea (PubChem CID 113018093) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[6-(2-tert-butylanilino)-3-pyridinyl]-3-cyclohexylurea.
| Compound Name | 1-[6-(2-tert-butylanilino)-3-pyridinyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 113018093 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 1-[6-(2-tert-butylanilino)-3-pyridinyl]-3-cyclohexylurea |
| SMILES | CC(C)(C)c1ccccc1Nc1ccc(NC(=O)NC2CCCCC2)cn1 |
| InChI | InChI=1S/C22H30N4O/c1-22(2,3)18-11-7-8-12-19(18)26-20-14-13-17(15-23-20)25-21(27)24-16-9-5-4-6-10-16/h7-8,11-16H,4-6,9-10H2,1-3H3,(H,23,26)(H2,24,25,27) |
| InChIKey | VSIMQLKUFBNUHE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |