C27H34O5S2 — CID 10929219
[(4R,6S,7S,11R,14S)-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-yl]methanol (PubChem CID 10929219) has the molecular formula C27H34O5S2 and a molecular weight of 502.70 g/mol. Its IUPAC name is [(4R,6S,7S,11R,14S)-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-yl]methanol.
| Compound Name | [(4R,6S,7S,11R,14S)-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-yl]methanol |
|---|---|
| PubChem CID | 10929219 |
| Molecular Formula | C27H34O5S2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [(4R,6S,7S,11R,14S)-4,11-bis(phenylsulfanylmethyl)-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-14-yl]methanol |
| SMILES | OC[C@H]1CO[C@]2(CCC[C@H](CSc3ccccc3)O2)[C@@]2(CCC[C@H](CSc3ccccc3)O2)O1 |
| InChI | InChI=1S/C27H34O5S2/c28-17-23-18-29-26(15-7-9-21(30-26)19-33-24-11-3-1-4-12-24)27(32-23)16-8-10-22(31-27)20-34-25-13-5-2-6-14-25/h1-6,11-14,21-23,28H,7-10,15-20H2/t21-,22-,23+,26+,27-/m1/s1 |
| InChIKey | DXWGGDRSQGKSKG-VJBPQSTDSA-N |
| XLogP | 5.51 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |