C16H18N4O4 — CID 109299759
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-methoxyethylamino)pyrimidine-4-carboxamide (PubChem CID 109299759) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-methoxyethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-methoxyethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109299759 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-methoxyethylamino)pyrimidine-4-carboxamide |
| SMILES | COCCNc1nccc(C(=O)Nc2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C16H18N4O4/c1-22-7-6-18-16-17-5-4-12(20-16)15(21)19-11-2-3-13-14(10-11)24-9-8-23-13/h2-5,10H,6-9H2,1H3,(H,19,21)(H,17,18,20) |
| InChIKey | ATDRIGVXKWZNEE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|