C40H47NO5Si2 — CID 10930418
(1S,2R,6R,10S,11S)-10,11-bis[[tert-butyl(diphenyl)silyl]oxy]-3,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-4-one (PubChem CID 10930418) has the molecular formula C40H47NO5Si2 and a molecular weight of 677.99 g/mol. Its IUPAC name is (1S,2R,6R,10S,11S)-10,11-bis[[tert-butyl(diphenyl)silyl]oxy]-3,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-4-one.
| Compound Name | (1S,2R,6R,10S,11S)-10,11-bis[[tert-butyl(diphenyl)silyl]oxy]-3,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-4-one |
|---|---|
| PubChem CID | 10930418 |
| Molecular Formula | C40H47NO5Si2 |
| Molecular Weight | 677.99 g/mol |
| Exact Mass | 677.30 |
| IUPAC Name | (1S,2R,6R,10S,11S)-10,11-bis[[tert-butyl(diphenyl)silyl]oxy]-3,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-4-one |
| SMILES | CC(C)(C)[Si](O[C@H]1[C@@H]2[C@H]3OC(=O)C[C@H]3ON2C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H47NO5Si2/c1-39(2,3)47(29-19-11-7-12-20-29,30-21-13-8-14-22-30)45-34-28-41-36(37-33(44-41)27-35(42)43-37)38(34)46-48(40(4,5)6,31-23-15-9-16-24-31)32-25-17-10-18-26-32/h7-26,33-34,36-38H,27-28H2,1-6H3/t33-,34+,36+,37+,38-/m1/s1 |
| InChIKey | XXIIXLPOLRXWLW-QRTCNGONSA-N |
| XLogP | 5.19 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.99 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|