C29H39NO5Si — CID 102251468
(1S,2R,5S,6S,11S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-11-[(2-methylpropan-2-yl)oxy]-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one (PubChem CID 102251468) has the molecular formula C29H39NO5Si and a molecular weight of 509.72 g/mol. Its IUPAC name is (1S,2R,5S,6S,11S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-11-[(2-methylpropan-2-yl)oxy]-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one.
| Compound Name | (1S,2R,5S,6S,11S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-11-[(2-methylpropan-2-yl)oxy]-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one |
|---|---|
| PubChem CID | 102251468 |
| Molecular Formula | C29H39NO5Si |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | (1S,2R,5S,6S,11S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-11-[(2-methylpropan-2-yl)oxy]-4,7-dioxa-8-azatricyclo[6.3.0.02,6]undecan-3-one |
| SMILES | CC(C)(C)O[C@H]1CCN2O[C@H]3[C@H](C(=O)O[C@H]3CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C29H39NO5Si/c1-28(2,3)34-22-17-18-30-25(22)24-26(35-30)23(33-27(24)31)19-32-36(29(4,5)6,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,22-26H,17-19H2,1-6H3/t22-,23-,24+,25+,26+/m0/s1 |
| InChIKey | DGQDCJMJXWQQPV-FZPKUJNRSA-N |
| XLogP | 3.68 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|