C20H20N4O — CID 109304225
N-(4-methylphenyl)-2-[(3-methylphenyl)methylamino]pyrimidine-4-carboxamide (PubChem CID 109304225) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[(3-methylphenyl)methylamino]pyrimidine-4-carboxamide.
| Compound Name | N-(4-methylphenyl)-2-[(3-methylphenyl)methylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109304225 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-(4-methylphenyl)-2-[(3-methylphenyl)methylamino]pyrimidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(NCc3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C20H20N4O/c1-14-6-8-17(9-7-14)23-19(25)18-10-11-21-20(24-18)22-13-16-5-3-4-15(2)12-16/h3-12H,13H2,1-2H3,(H,23,25)(H,21,22,24) |
| InChIKey | IJYFVINBWISRRU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |