C20H19ClN4O — CID 109304314
2-[(4-chlorophenyl)methylamino]-N-[(3-methylphenyl)methyl]pyrimidine-4-carboxamide (PubChem CID 109304314) has the molecular formula C20H19ClN4O and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylamino]-N-[(3-methylphenyl)methyl]pyrimidine-4-carboxamide.
| Compound Name | 2-[(4-chlorophenyl)methylamino]-N-[(3-methylphenyl)methyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109304314 |
| Molecular Formula | C20H19ClN4O |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[(4-chlorophenyl)methylamino]-N-[(3-methylphenyl)methyl]pyrimidine-4-carboxamide |
| SMILES | Cc1cccc(CNC(=O)c2ccnc(NCc3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C20H19ClN4O/c1-14-3-2-4-16(11-14)13-23-19(26)18-9-10-22-20(25-18)24-12-15-5-7-17(21)8-6-15/h2-11H,12-13H2,1H3,(H,23,26)(H,22,24,25) |
| InChIKey | GXYMGHZGEZOXEP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |