C23H26N4O — CID 109305045
2-[benzyl(methyl)amino]-N-(4-tert-butylphenyl)pyrimidine-4-carboxamide (PubChem CID 109305045) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-N-(4-tert-butylphenyl)pyrimidine-4-carboxamide.
| Compound Name | 2-[benzyl(methyl)amino]-N-(4-tert-butylphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109305045 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-[benzyl(methyl)amino]-N-(4-tert-butylphenyl)pyrimidine-4-carboxamide |
| SMILES | CN(Cc1ccccc1)c1nccc(C(=O)Nc2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C23H26N4O/c1-23(2,3)18-10-12-19(13-11-18)25-21(28)20-14-15-24-22(26-20)27(4)16-17-8-6-5-7-9-17/h5-15H,16H2,1-4H3,(H,25,28) |
| InChIKey | DYWMNSPOJRZHMQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |