C15H17FN4O — CID 109310906
N,N-diethyl-2-(3-fluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109310906) has the molecular formula C15H17FN4O and a molecular weight of 288.33 g/mol. Its IUPAC name is N,N-diethyl-2-(3-fluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N,N-diethyl-2-(3-fluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109310906 |
| Molecular Formula | C15H17FN4O |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N,N-diethyl-2-(3-fluoroanilino)pyrimidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccnc(Nc2cccc(F)c2)n1 |
| InChI | InChI=1S/C15H17FN4O/c1-3-20(4-2)14(21)13-8-9-17-15(19-13)18-12-7-5-6-11(16)10-12/h5-10H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | XCKUAYRUUXXIAF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |