C17H11Cl2FN4O — CID 109318480
N-(2,6-dichlorophenyl)-2-(3-fluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109318480) has the molecular formula C17H11Cl2FN4O and a molecular weight of 377.21 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-(3-fluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-(3-fluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109318480 |
| Molecular Formula | C17H11Cl2FN4O |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-(3-fluoroanilino)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1c(Cl)cccc1Cl)c1ccnc(Nc2cccc(F)c2)n1 |
| InChI | InChI=1S/C17H11Cl2FN4O/c18-12-5-2-6-13(19)15(12)24-16(25)14-7-8-21-17(23-14)22-11-4-1-3-10(20)9-11/h1-9H,(H,24,25)(H,21,22,23) |
| InChIKey | WIMQRQVNSCKNDQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |