C22H21N5O — CID 109311728
N-benzyl-2-(3-cyanoanilino)-N-propan-2-ylpyrimidine-4-carboxamide (PubChem CID 109311728) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is N-benzyl-2-(3-cyanoanilino)-N-propan-2-ylpyrimidine-4-carboxamide.
| Compound Name | N-benzyl-2-(3-cyanoanilino)-N-propan-2-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109311728 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-benzyl-2-(3-cyanoanilino)-N-propan-2-ylpyrimidine-4-carboxamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)c1ccnc(Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C22H21N5O/c1-16(2)27(15-17-7-4-3-5-8-17)21(28)20-11-12-24-22(26-20)25-19-10-6-9-18(13-19)14-23/h3-13,16H,15H2,1-2H3,(H,24,25,26) |
| InChIKey | SBWIPALIZKMCTI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |