C17H19N5O — CID 109311960
2-(3-cyanoanilino)-N-(3-methylbutyl)pyrimidine-4-carboxamide (PubChem CID 109311960) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(3-cyanoanilino)-N-(3-methylbutyl)pyrimidine-4-carboxamide.
| Compound Name | 2-(3-cyanoanilino)-N-(3-methylbutyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109311960 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-(3-cyanoanilino)-N-(3-methylbutyl)pyrimidine-4-carboxamide |
| SMILES | CC(C)CCNC(=O)c1ccnc(Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C17H19N5O/c1-12(2)6-8-19-16(23)15-7-9-20-17(22-15)21-14-5-3-4-13(10-14)11-18/h3-5,7,9-10,12H,6,8H2,1-2H3,(H,19,23)(H,20,21,22) |
| InChIKey | KHBRINZIPFTYAE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |