C16H28N4O — CID 109311740
2-(3-methylbutylamino)-N,N-dipropylpyrimidine-4-carboxamide (PubChem CID 109311740) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-(3-methylbutylamino)-N,N-dipropylpyrimidine-4-carboxamide.
| Compound Name | 2-(3-methylbutylamino)-N,N-dipropylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109311740 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 2-(3-methylbutylamino)-N,N-dipropylpyrimidine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccnc(NCCC(C)C)n1 |
| InChI | InChI=1S/C16H28N4O/c1-5-11-20(12-6-2)15(21)14-8-10-18-16(19-14)17-9-7-13(3)4/h8,10,13H,5-7,9,11-12H2,1-4H3,(H,17,18,19) |
| InChIKey | ZURFLGUZJIQRLZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |