C20H28N4O — CID 109313001
N,N-dipropyl-2-(2,4,6-trimethylanilino)pyrimidine-4-carboxamide (PubChem CID 109313001) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is N,N-dipropyl-2-(2,4,6-trimethylanilino)pyrimidine-4-carboxamide.
| Compound Name | N,N-dipropyl-2-(2,4,6-trimethylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109313001 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | N,N-dipropyl-2-(2,4,6-trimethylanilino)pyrimidine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccnc(Nc2c(C)cc(C)cc2C)n1 |
| InChI | InChI=1S/C20H28N4O/c1-6-10-24(11-7-2)19(25)17-8-9-21-20(22-17)23-18-15(4)12-14(3)13-16(18)5/h8-9,12-13H,6-7,10-11H2,1-5H3,(H,21,22,23) |
| InChIKey | CUABKWUQDNYGOS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |