C19H26N4O3 — CID 109313029
2-(2,5-dimethoxyanilino)-N,N-dipropylpyrimidine-4-carboxamide (PubChem CID 109313029) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-(2,5-dimethoxyanilino)-N,N-dipropylpyrimidine-4-carboxamide.
| Compound Name | 2-(2,5-dimethoxyanilino)-N,N-dipropylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109313029 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2-(2,5-dimethoxyanilino)-N,N-dipropylpyrimidine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccnc(Nc2cc(OC)ccc2OC)n1 |
| InChI | InChI=1S/C19H26N4O3/c1-5-11-23(12-6-2)18(24)15-9-10-20-19(21-15)22-16-13-14(25-3)7-8-17(16)26-4/h7-10,13H,5-6,11-12H2,1-4H3,(H,20,21,22) |
| InChIKey | LLYCNEIENRYRGR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |