C18H24N4O2 — CID 109313021
2-(2-methoxyanilino)-N,N-dipropylpyrimidine-4-carboxamide (PubChem CID 109313021) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-N,N-dipropylpyrimidine-4-carboxamide.
| Compound Name | 2-(2-methoxyanilino)-N,N-dipropylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109313021 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-(2-methoxyanilino)-N,N-dipropylpyrimidine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccnc(Nc2ccccc2OC)n1 |
| InChI | InChI=1S/C18H24N4O2/c1-4-12-22(13-5-2)17(23)15-10-11-19-18(21-15)20-14-8-6-7-9-16(14)24-3/h6-11H,4-5,12-13H2,1-3H3,(H,19,20,21) |
| InChIKey | LTLDXADPWBZIQW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |