C20H19FN4O — CID 109316170
N-(4-fluorophenyl)-2-(2,4,6-trimethylanilino)pyrimidine-4-carboxamide (PubChem CID 109316170) has the molecular formula C20H19FN4O and a molecular weight of 350.40 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(2,4,6-trimethylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2-(2,4,6-trimethylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109316170 |
| Molecular Formula | C20H19FN4O |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-(4-fluorophenyl)-2-(2,4,6-trimethylanilino)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C)c(Nc2nccc(C(=O)Nc3ccc(F)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C20H19FN4O/c1-12-10-13(2)18(14(3)11-12)25-20-22-9-8-17(24-20)19(26)23-16-6-4-15(21)5-7-16/h4-11H,1-3H3,(H,23,26)(H,22,24,25) |
| InChIKey | AQCMPPBWXUZAIX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |