C20H25N5O — CID 109320846
N-[2-(1H-indol-3-yl)ethyl]-6-methyl-2-(2-methylpropylamino)pyrimidine-4-carboxamide (PubChem CID 109320846) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-6-methyl-2-(2-methylpropylamino)pyrimidine-4-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-6-methyl-2-(2-methylpropylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109320846 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-6-methyl-2-(2-methylpropylamino)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCc2c[nH]c3ccccc23)nc(NCC(C)C)n1 |
| InChI | InChI=1S/C20H25N5O/c1-13(2)11-23-20-24-14(3)10-18(25-20)19(26)21-9-8-15-12-22-17-7-5-4-6-16(15)17/h4-7,10,12-13,22H,8-9,11H2,1-3H3,(H,21,26)(H,23,24,25) |
| InChIKey | JZXKKLSROHQQJW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |