C16H16N4O — CID 146080613
N-[2-(1H-indol-3-yl)ethyl]-6-methylpyrazine-2-carboxamide (PubChem CID 146080613) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-6-methylpyrazine-2-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-6-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 146080613 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-6-methylpyrazine-2-carboxamide |
| SMILES | Cc1cncc(C(=O)NCCc2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C16H16N4O/c1-11-8-17-10-15(20-11)16(21)18-7-6-12-9-19-14-5-3-2-4-13(12)14/h2-5,8-10,19H,6-7H2,1H3,(H,18,21) |
| InChIKey | NYYHLDGDJMYNGF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |