C15H23N5O2 — CID 109321194
4-[2-(butan-2-ylamino)-6-methylpyrimidine-4-carbonyl]piperazine-1-carbaldehyde (PubChem CID 109321194) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-[2-(butan-2-ylamino)-6-methylpyrimidine-4-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-(butan-2-ylamino)-6-methylpyrimidine-4-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 109321194 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 4-[2-(butan-2-ylamino)-6-methylpyrimidine-4-carbonyl]piperazine-1-carbaldehyde |
| SMILES | CCC(C)Nc1nc(C)cc(C(=O)N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C15H23N5O2/c1-4-11(2)16-15-17-12(3)9-13(18-15)14(22)20-7-5-19(10-21)6-8-20/h9-11H,4-8H2,1-3H3,(H,16,17,18) |
| InChIKey | XHDHCJKXWSZHSR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|