C8H12O5 — CID 10932186
[(2R,4R,5R)-5-formyl-2-methyl-1,3-dioxolan-4-yl]methyl acetate (PubChem CID 10932186) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is [(2R,4R,5R)-5-formyl-2-methyl-1,3-dioxolan-4-yl]methyl acetate.
| Compound Name | [(2R,4R,5R)-5-formyl-2-methyl-1,3-dioxolan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 10932186 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | [(2R,4R,5R)-5-formyl-2-methyl-1,3-dioxolan-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](C)O[C@H]1C=O |
| InChI | InChI=1S/C8H12O5/c1-5(10)11-4-8-7(3-9)12-6(2)13-8/h3,6-8H,4H2,1-2H3/t6-,7-,8+/m0/s1 |
| InChIKey | BMMUECMNIXRTNV-BIIVOSGPSA-N |
| XLogP | -0.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|