C20H25N5O2 — CID 109322742
N-(4-acetamidophenyl)-2-(cyclohexylamino)-6-methylpyrimidine-4-carboxamide (PubChem CID 109322742) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-(cyclohexylamino)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-2-(cyclohexylamino)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109322742 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-(4-acetamidophenyl)-2-(cyclohexylamino)-6-methylpyrimidine-4-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cc(C)nc(NC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C20H25N5O2/c1-13-12-18(25-20(21-13)24-15-6-4-3-5-7-15)19(27)23-17-10-8-16(9-11-17)22-14(2)26/h8-12,15H,3-7H2,1-2H3,(H,22,26)(H,23,27)(H,21,24,25) |
| InChIKey | FHYIBRWZWQNUGN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |