C21H27N5O2 — CID 109332901
N-(3-acetamidophenyl)-2-(cycloheptylamino)-6-methylpyrimidine-4-carboxamide (PubChem CID 109332901) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-(cycloheptylamino)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-(3-acetamidophenyl)-2-(cycloheptylamino)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109332901 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-(3-acetamidophenyl)-2-(cycloheptylamino)-6-methylpyrimidine-4-carboxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)c2cc(C)nc(NC3CCCCCC3)n2)c1 |
| InChI | InChI=1S/C21H27N5O2/c1-14-12-19(26-21(22-14)25-16-8-5-3-4-6-9-16)20(28)24-18-11-7-10-17(13-18)23-15(2)27/h7,10-13,16H,3-6,8-9H2,1-2H3,(H,23,27)(H,24,28)(H,22,25,26) |
| InChIKey | YMKWTAOWOAXSGM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |