C18H23N5O — CID 112909921
N-[3-[[2-(cyclopentylamino)-6-methylpyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 112909921) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[3-[[2-(cyclopentylamino)-6-methylpyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[2-(cyclopentylamino)-6-methylpyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112909921 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-[3-[[2-(cyclopentylamino)-6-methylpyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2cc(C)nc(NC3CCCC3)n2)c1 |
| InChI | InChI=1S/C18H23N5O/c1-12-10-17(23-18(19-12)22-14-6-3-4-7-14)21-16-9-5-8-15(11-16)20-13(2)24/h5,8-11,14H,3-4,6-7H2,1-2H3,(H,20,24)(H2,19,21,22,23) |
| InChIKey | LJRMGFUWPHYEEJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |