C19H26N4O2 — CID 109324110
2-(2-ethyl-6-methylanilino)-N-(3-methoxypropyl)-6-methylpyrimidine-4-carboxamide (PubChem CID 109324110) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-(2-ethyl-6-methylanilino)-N-(3-methoxypropyl)-6-methylpyrimidine-4-carboxamide.
| Compound Name | 2-(2-ethyl-6-methylanilino)-N-(3-methoxypropyl)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109324110 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 2-(2-ethyl-6-methylanilino)-N-(3-methoxypropyl)-6-methylpyrimidine-4-carboxamide |
| SMILES | CCc1cccc(C)c1Nc1nc(C)cc(C(=O)NCCCOC)n1 |
| InChI | InChI=1S/C19H26N4O2/c1-5-15-9-6-8-13(2)17(15)23-19-21-14(3)12-16(22-19)18(24)20-10-7-11-25-4/h6,8-9,12H,5,7,10-11H2,1-4H3,(H,20,24)(H,21,22,23) |
| InChIKey | NSURHVYJADCMJF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|