C18H22N4O4 — CID 109324151
methyl 2-[[4-(3-methoxypropylcarbamoyl)-6-methylpyrimidin-2-yl]amino]benzoate (PubChem CID 109324151) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is methyl 2-[[4-(3-methoxypropylcarbamoyl)-6-methylpyrimidin-2-yl]amino]benzoate.
| Compound Name | methyl 2-[[4-(3-methoxypropylcarbamoyl)-6-methylpyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 109324151 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | methyl 2-[[4-(3-methoxypropylcarbamoyl)-6-methylpyrimidin-2-yl]amino]benzoate |
| SMILES | COCCCNC(=O)c1cc(C)nc(Nc2ccccc2C(=O)OC)n1 |
| InChI | InChI=1S/C18H22N4O4/c1-12-11-15(16(23)19-9-6-10-25-2)22-18(20-12)21-14-8-5-4-7-13(14)17(24)26-3/h4-5,7-8,11H,6,9-10H2,1-3H3,(H,19,23)(H,20,21,22) |
| InChIKey | UEYXRPCKVIDPGP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|