C16H29N5O — CID 109325078
N-[2-(dimethylamino)ethyl]-2-(dipropylamino)-6-methylpyrimidine-4-carboxamide (PubChem CID 109325078) has the molecular formula C16H29N5O and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-(dipropylamino)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-(dipropylamino)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109325078 |
| Molecular Formula | C16H29N5O |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-(dipropylamino)-6-methylpyrimidine-4-carboxamide |
| SMILES | CCCN(CCC)c1nc(C)cc(C(=O)NCCN(C)C)n1 |
| InChI | InChI=1S/C16H29N5O/c1-6-9-21(10-7-2)16-18-13(3)12-14(19-16)15(22)17-8-11-20(4)5/h12H,6-11H2,1-5H3,(H,17,22) |
| InChIKey | VLYHMHVAHDNUEK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |