C20H25N5O3 — CID 109325276
N-(4-acetylphenyl)-6-methyl-2-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide (PubChem CID 109325276) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(4-acetylphenyl)-6-methyl-2-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(4-acetylphenyl)-6-methyl-2-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109325276 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-(4-acetylphenyl)-6-methyl-2-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2cc(C)nc(NCCN3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C20H25N5O3/c1-14-13-18(19(27)23-17-5-3-16(4-6-17)15(2)26)24-20(22-14)21-7-8-25-9-11-28-12-10-25/h3-6,13H,7-12H2,1-2H3,(H,23,27)(H,21,22,24) |
| InChIKey | YIPHDAQVQAGSRP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |