C18H22FN5O2 — CID 109325283
N-(3-fluorophenyl)-6-methyl-2-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide (PubChem CID 109325283) has the molecular formula C18H22FN5O2 and a molecular weight of 359.41 g/mol. Its IUPAC name is N-(3-fluorophenyl)-6-methyl-2-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(3-fluorophenyl)-6-methyl-2-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109325283 |
| Molecular Formula | C18H22FN5O2 |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-(3-fluorophenyl)-6-methyl-2-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(F)c2)nc(NCCN2CCOCC2)n1 |
| InChI | InChI=1S/C18H22FN5O2/c1-13-11-16(17(25)22-15-4-2-3-14(19)12-15)23-18(21-13)20-5-6-24-7-9-26-10-8-24/h2-4,11-12H,5-10H2,1H3,(H,22,25)(H,20,21,23) |
| InChIKey | DWAWGULGHYOMRF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |