C12H22OSi — CID 10932733
[(2S,3R,7E)-7-(trimethylsilylmethylidene)spiro[2.4]heptan-2-yl]methanol (PubChem CID 10932733) has the molecular formula C12H22OSi and a molecular weight of 210.39 g/mol. Its IUPAC name is [(2S,3R,7E)-7-(trimethylsilylmethylidene)spiro[2.4]heptan-2-yl]methanol.
| Compound Name | [(2S,3R,7E)-7-(trimethylsilylmethylidene)spiro[2.4]heptan-2-yl]methanol |
|---|---|
| PubChem CID | 10932733 |
| Molecular Formula | C12H22OSi |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | [(2S,3R,7E)-7-(trimethylsilylmethylidene)spiro[2.4]heptan-2-yl]methanol |
| SMILES | C[Si](C)(C)/C=C1\CCC[C@]12C[C@@H]2CO |
| InChI | InChI=1S/C12H22OSi/c1-14(2,3)9-10-5-4-6-12(10)7-11(12)8-13/h9,11,13H,4-8H2,1-3H3/b10-9+/t11-,12+/m1/s1 |
| InChIKey | RPOIZXYCSWOKPR-ZGFRAZBVSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|