C22H30N4O — CID 109329487
[2-[benzyl(ethyl)amino]-6-methylpyrimidin-4-yl]-(2-ethylpiperidin-1-yl)methanone (PubChem CID 109329487) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is [2-[benzyl(ethyl)amino]-6-methylpyrimidin-4-yl]-(2-ethylpiperidin-1-yl)methanone.
| Compound Name | [2-[benzyl(ethyl)amino]-6-methylpyrimidin-4-yl]-(2-ethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109329487 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | [2-[benzyl(ethyl)amino]-6-methylpyrimidin-4-yl]-(2-ethylpiperidin-1-yl)methanone |
| SMILES | CCC1CCCCN1C(=O)c1cc(C)nc(N(CC)Cc2ccccc2)n1 |
| InChI | InChI=1S/C22H30N4O/c1-4-19-13-9-10-14-26(19)21(27)20-15-17(3)23-22(24-20)25(5-2)16-18-11-7-6-8-12-18/h6-8,11-12,15,19H,4-5,9-10,13-14,16H2,1-3H3 |
| InChIKey | JCNJMMBXLGYWHT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |