C23H31N5O — CID 109333992
6-methyl-2-(3-methylpiperidin-1-yl)-N-(4-piperidin-1-ylphenyl)pyrimidine-4-carboxamide (PubChem CID 109333992) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is 6-methyl-2-(3-methylpiperidin-1-yl)-N-(4-piperidin-1-ylphenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-methyl-2-(3-methylpiperidin-1-yl)-N-(4-piperidin-1-ylphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109333992 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 6-methyl-2-(3-methylpiperidin-1-yl)-N-(4-piperidin-1-ylphenyl)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(N3CCCCC3)cc2)nc(N2CCCC(C)C2)n1 |
| InChI | InChI=1S/C23H31N5O/c1-17-7-6-14-28(16-17)23-24-18(2)15-21(26-23)22(29)25-19-8-10-20(11-9-19)27-12-4-3-5-13-27/h8-11,15,17H,3-7,12-14,16H2,1-2H3,(H,25,29) |
| InChIKey | OHYFXEHXTFVXIV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|