C14H12F2N4O — CID 109339410
N-cyclopropyl-6-(2,6-difluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109339410) has the molecular formula C14H12F2N4O and a molecular weight of 290.27 g/mol. Its IUPAC name is N-cyclopropyl-6-(2,6-difluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-cyclopropyl-6-(2,6-difluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109339410 |
| Molecular Formula | C14H12F2N4O |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | N-cyclopropyl-6-(2,6-difluoroanilino)pyrimidine-4-carboxamide |
| SMILES | O=C(NC1CC1)c1cc(Nc2c(F)cccc2F)ncn1 |
| InChI | InChI=1S/C14H12F2N4O/c15-9-2-1-3-10(16)13(9)20-12-6-11(17-7-18-12)14(21)19-8-4-5-8/h1-3,6-8H,4-5H2,(H,19,21)(H,17,18,20) |
| InChIKey | NRKHAKSZKHDTNN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |