C19H15ClF2N4O — CID 109352406
N-[2-(4-chlorophenyl)ethyl]-6-(2,6-difluoroanilino)pyrimidine-4-carboxamide (PubChem CID 109352406) has the molecular formula C19H15ClF2N4O and a molecular weight of 388.81 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-6-(2,6-difluoroanilino)pyrimidine-4-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-6-(2,6-difluoroanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109352406 |
| Molecular Formula | C19H15ClF2N4O |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-6-(2,6-difluoroanilino)pyrimidine-4-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1cc(Nc2c(F)cccc2F)ncn1 |
| InChI | InChI=1S/C19H15ClF2N4O/c20-13-6-4-12(5-7-13)8-9-23-19(27)16-10-17(25-11-24-16)26-18-14(21)2-1-3-15(18)22/h1-7,10-11H,8-9H2,(H,23,27)(H,24,25,26) |
| InChIKey | VRAJLWDDLKQASX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |