C18H22N4O — CID 109340038
N-butyl-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidine-4-carboxamide (PubChem CID 109340038) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-butyl-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidine-4-carboxamide.
| Compound Name | N-butyl-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109340038 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-butyl-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidine-4-carboxamide |
| SMILES | CCCCNC(=O)c1cc(N2CCc3ccccc3C2)ncn1 |
| InChI | InChI=1S/C18H22N4O/c1-2-3-9-19-18(23)16-11-17(21-13-20-16)22-10-8-14-6-4-5-7-15(14)12-22/h4-7,11,13H,2-3,8-10,12H2,1H3,(H,19,23) |
| InChIKey | MMXWCJSFQCWRHH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|