C17H20N4O3 — CID 109340166
N-butyl-6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)pyrimidine-4-carboxamide (PubChem CID 109340166) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-butyl-6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)pyrimidine-4-carboxamide.
| Compound Name | N-butyl-6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109340166 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-butyl-6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)pyrimidine-4-carboxamide |
| SMILES | CCCCNC(=O)c1cc(Nc2ccc3c(c2)OCCO3)ncn1 |
| InChI | InChI=1S/C17H20N4O3/c1-2-3-6-18-17(22)13-10-16(20-11-19-13)21-12-4-5-14-15(9-12)24-8-7-23-14/h4-5,9-11H,2-3,6-8H2,1H3,(H,18,22)(H,19,20,21) |
| InChIKey | UZQFGUOSEJHMGW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|