C21H21N5O3 — CID 109359576
6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-[4-(dimethylamino)phenyl]pyrimidine-4-carboxamide (PubChem CID 109359576) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-[4-(dimethylamino)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-[4-(dimethylamino)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109359576 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-N-[4-(dimethylamino)phenyl]pyrimidine-4-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cc(Nc3ccc4c(c3)OCCO4)ncn2)cc1 |
| InChI | InChI=1S/C21H21N5O3/c1-26(2)16-6-3-14(4-7-16)25-21(27)17-12-20(23-13-22-17)24-15-5-8-18-19(11-15)29-10-9-28-18/h3-8,11-13H,9-10H2,1-2H3,(H,25,27)(H,22,23,24) |
| InChIKey | UAKWUTLOCPBONH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|