C12H20O4S — CID 10934228
(3aR,4S,7aR)-4-tert-butylsulfanyl-2,2-dimethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one (PubChem CID 10934228) has the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. Its IUPAC name is (3aR,4S,7aR)-4-tert-butylsulfanyl-2,2-dimethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one.
| Compound Name | (3aR,4S,7aR)-4-tert-butylsulfanyl-2,2-dimethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one |
|---|---|
| PubChem CID | 10934228 |
| Molecular Formula | C12H20O4S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (3aR,4S,7aR)-4-tert-butylsulfanyl-2,2-dimethyl-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-one |
| SMILES | CC1(C)O[C@H]2[C@H](SC(C)(C)C)OCC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C12H20O4S/c1-11(2,3)17-10-9-8(7(13)6-14-10)15-12(4,5)16-9/h8-10H,6H2,1-5H3/t8-,9+,10-/m0/s1 |
| InChIKey | OGROTSSVDRRDCL-AEJSXWLSSA-N |
| XLogP | 1.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |