C12H20O6S — CID 162409782
methyl (2R,3R,4aR,5S,7aR)-2,3-dimethoxy-2,3-dimethyl-4a,5,7,7a-tetrahydrothieno[3,4-b][1,4]dioxine-5-carboxylate (PubChem CID 162409782) has the molecular formula C12H20O6S and a molecular weight of 292.35 g/mol. Its IUPAC name is methyl (2R,3R,4aR,5S,7aR)-2,3-dimethoxy-2,3-dimethyl-4a,5,7,7a-tetrahydrothieno[3,4-b][1,4]dioxine-5-carboxylate.
| Compound Name | methyl (2R,3R,4aR,5S,7aR)-2,3-dimethoxy-2,3-dimethyl-4a,5,7,7a-tetrahydrothieno[3,4-b][1,4]dioxine-5-carboxylate |
|---|---|
| PubChem CID | 162409782 |
| Molecular Formula | C12H20O6S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | methyl (2R,3R,4aR,5S,7aR)-2,3-dimethoxy-2,3-dimethyl-4a,5,7,7a-tetrahydrothieno[3,4-b][1,4]dioxine-5-carboxylate |
| SMILES | COC(=O)[C@H]1SC[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@H]21 |
| InChI | InChI=1S/C12H20O6S/c1-11(15-4)12(2,16-5)18-8-7(17-11)6-19-9(8)10(13)14-3/h7-9H,6H2,1-5H3/t7-,8+,9-,11+,12+/m0/s1 |
| InChIKey | INQXWUVYEVROIC-ORZSEXNPSA-N |
| XLogP | 0.78 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |