C14H24O6S — CID 11427195
[(3aR,4S,6R,7S,7aR)-2-ethoxy-6-ethylsulfanyl-2,4-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate (PubChem CID 11427195) has the molecular formula C14H24O6S and a molecular weight of 320.41 g/mol. Its IUPAC name is [(3aR,4S,6R,7S,7aR)-2-ethoxy-6-ethylsulfanyl-2,4-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate.
| Compound Name | [(3aR,4S,6R,7S,7aR)-2-ethoxy-6-ethylsulfanyl-2,4-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 11427195 |
| Molecular Formula | C14H24O6S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(3aR,4S,6R,7S,7aR)-2-ethoxy-6-ethylsulfanyl-2,4-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
| SMILES | CCOC1(C)O[C@@H]2[C@H](O1)[C@H](C)O[C@H](SCC)[C@H]2OC(C)=O |
| InChI | InChI=1S/C14H24O6S/c1-6-16-14(5)19-10-8(3)17-13(21-7-2)12(11(10)20-14)18-9(4)15/h8,10-13H,6-7H2,1-5H3/t8-,10+,11+,12-,13+,14?/m0/s1 |
| InChIKey | VEHPICMUPILUQB-PXLLIYEHSA-N |
| XLogP | 1.91 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |