C12H16O7S — CID 15704780
[(1S,2S,3S,4S,5S)-3,4-diacetyloxy-8-oxa-6-thiabicyclo[3.2.1]octan-2-yl] acetate (PubChem CID 15704780) has the molecular formula C12H16O7S and a molecular weight of 304.32 g/mol. Its IUPAC name is [(1S,2S,3S,4S,5S)-3,4-diacetyloxy-8-oxa-6-thiabicyclo[3.2.1]octan-2-yl] acetate.
| Compound Name | [(1S,2S,3S,4S,5S)-3,4-diacetyloxy-8-oxa-6-thiabicyclo[3.2.1]octan-2-yl] acetate |
|---|---|
| PubChem CID | 15704780 |
| Molecular Formula | C12H16O7S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | [(1S,2S,3S,4S,5S)-3,4-diacetyloxy-8-oxa-6-thiabicyclo[3.2.1]octan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@H]2CS[C@H](O2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H16O7S/c1-5(13)16-9-8-4-20-12(19-8)11(18-7(3)15)10(9)17-6(2)14/h8-12H,4H2,1-3H3/t8-,9-,10+,11+,12+/m1/s1 |
| InChIKey | LJULAVJLIRMOER-GCHJQGSQSA-N |
| XLogP | 0.25 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|