C13H18O8S — CID 10991244
[(3S,4S,5R)-4,5,6-triacetyloxythian-3-yl] acetate (PubChem CID 10991244) has the molecular formula C13H18O8S and a molecular weight of 334.35 g/mol. Its IUPAC name is [(3S,4S,5R)-4,5,6-triacetyloxythian-3-yl] acetate.
| Compound Name | [(3S,4S,5R)-4,5,6-triacetyloxythian-3-yl] acetate |
|---|---|
| PubChem CID | 10991244 |
| Molecular Formula | C13H18O8S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [(3S,4S,5R)-4,5,6-triacetyloxythian-3-yl] acetate |
| SMILES | CC(=O)OC1SC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H18O8S/c1-6(14)18-10-5-22-13(21-9(4)17)12(20-8(3)16)11(10)19-7(2)15/h10-13H,5H2,1-4H3/t10-,11+,12-,13?/m1/s1 |
| InChIKey | JEGLENJOJVLAIW-DAAZQVBGSA-N |
| XLogP | 0.42 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|